About dimethyl-(2-methyl-1,3-diphenylpropan-2-yl)-λ3-iodane
dimethyl-(2-methyl-1,3-diphenylpropan-2-yl)-λ3-iodane (PubChem CID 147576480) has the molecular formula C18H23I
and a molecular weight of 366.29 g/mol. Its IUPAC name is dimethyl-(2-methyl-1,3-diphenylpropan-2-yl)-λ3-iodane.
Molecular Properties
| Compound Name | dimethyl-(2-methyl-1,3-diphenylpropan-2-yl)-λ3-iodane |
| PubChem CID | 147576480 |
| Molecular Formula | C18H23I |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | dimethyl-(2-methyl-1,3-diphenylpropan-2-yl)-λ3-iodane |
| SMILES | CI(C)C(C)(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C18H23I/c1-18(19(2)3,14-16-10-6-4-7-11-16)15-17-12-8-5-9-13-17/h4-13H,14-15H2,1-3H3 |
| InChIKey | FVOOTGQXNDESDG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-(2-methyl-1,3-diphenylpropan-2-yl)-λ3-iodane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-(2-methyl-1,3-diphenylpropan-2-yl)-λ3-iodane?
The IUPAC name of dimethyl-(2-methyl-1,3-diphenylpropan-2-yl)-λ3-iodane (CID 147576480) is dimethyl-(2-methyl-1,3-diphenylpropan-2-yl)-λ3-iodane.
What is the SMILES notation for dimethyl-(2-methyl-1,3-diphenylpropan-2-yl)-λ3-iodane?
The canonical SMILES for dimethyl-(2-methyl-1,3-diphenylpropan-2-yl)-λ3-iodane is CI(C)C(C)(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of dimethyl-(2-methyl-1,3-diphenylpropan-2-yl)-λ3-iodane?
The InChIKey is FVOOTGQXNDESDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23I/c1-18(19(2)3,14-16-10-6-4-7-11-16)15-17-12-8-5-9-13-17/h4-13H,14-15H2,1-3H3.
What are the key properties of dimethyl-(2-methyl-1,3-diphenylpropan-2-yl)-λ3-iodane?
dimethyl-(2-methyl-1,3-diphenylpropan-2-yl)-λ3-iodane has a molecular weight of 366.29 g/mol, XLogP of 5.00, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-(2-methyl-1,3-diphenylpropan-2-yl)-λ3-iodane is sourced from PubChem (CID 147576480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).