C25H29NO — CID 124808457
(2R,3S)-4-[benzyl(methyl)amino]-3-methyl-1,2-diphenylbutan-2-ol (PubChem CID 124808457) has the molecular formula C25H29NO and a molecular weight of 359.51 g/mol. Its IUPAC name is (2R,3S)-4-[benzyl(methyl)amino]-3-methyl-1,2-diphenylbutan-2-ol.
| Compound Name | (2R,3S)-4-[benzyl(methyl)amino]-3-methyl-1,2-diphenylbutan-2-ol |
|---|---|
| PubChem CID | 124808457 |
| Molecular Formula | C25H29NO |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | (2R,3S)-4-[benzyl(methyl)amino]-3-methyl-1,2-diphenylbutan-2-ol |
| SMILES | C[C@@H](CN(C)Cc1ccccc1)[C@](O)(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H29NO/c1-21(19-26(2)20-23-14-8-4-9-15-23)25(27,24-16-10-5-11-17-24)18-22-12-6-3-7-13-22/h3-17,21,27H,18-20H2,1-2H3/t21-,25+/m0/s1 |
| InChIKey | UNNQDXMODLDYNT-SQJMNOBHSA-N |
| XLogP | 4.89 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |