C28H31NO5-2 — CID 20978051
3-methyl-1,2-diphenyl-4-(1-phenylpropan-2-ylamino)butan-2-ol;oxalate (PubChem CID 20978051) has the molecular formula C28H31NO5-2 and a molecular weight of 461.56 g/mol. Its IUPAC name is 3-methyl-1,2-diphenyl-4-(1-phenylpropan-2-ylamino)butan-2-ol;oxalate.
| Compound Name | 3-methyl-1,2-diphenyl-4-(1-phenylpropan-2-ylamino)butan-2-ol;oxalate |
|---|---|
| PubChem CID | 20978051 |
| Molecular Formula | C28H31NO5-2 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 3-methyl-1,2-diphenyl-4-(1-phenylpropan-2-ylamino)butan-2-ol;oxalate |
| SMILES | CC(Cc1ccccc1)NCC(C)C(O)(Cc1ccccc1)c1ccccc1.O=C([O-])C(=O)[O-] |
| InChI | InChI=1S/C26H31NO.C2H2O4/c1-21(20-27-22(2)18-23-12-6-3-7-13-23)26(28,25-16-10-5-11-17-25)19-24-14-8-4-9-15-24;3-1(4)2(5)6/h3-17,21-22,27-28H,18-20H2,1-2H3;(H,3,4)(H,5,6)/p-2 |
| InChIKey | LBOJKPXYPCAPMQ-UHFFFAOYSA-L |
| XLogP | 1.46 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|