C12H18FNO3S — CID 58691935
(2S)-2-fluoro-3-(1-phenylpropan-2-ylamino)propane-1-sulfonic acid (PubChem CID 58691935) has the molecular formula C12H18FNO3S and a molecular weight of 275.34 g/mol. Its IUPAC name is (2S)-2-fluoro-3-(1-phenylpropan-2-ylamino)propane-1-sulfonic acid.
| Compound Name | (2S)-2-fluoro-3-(1-phenylpropan-2-ylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 58691935 |
| Molecular Formula | C12H18FNO3S |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | (2S)-2-fluoro-3-(1-phenylpropan-2-ylamino)propane-1-sulfonic acid |
| SMILES | CC(Cc1ccccc1)NC[C@H](F)CS(=O)(=O)O |
| InChI | InChI=1S/C12H18FNO3S/c1-10(7-11-5-3-2-4-6-11)14-8-12(13)9-18(15,16)17/h2-6,10,12,14H,7-9H2,1H3,(H,15,16,17)/t10?,12-/m0/s1 |
| InChIKey | DDZDOFXUQRWZSE-KFJBMODSSA-N |
| XLogP | 1.43 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|