C16H20O4 — CID 134947165
tert-butyl (2R)-2-hydroxy-2-(4-methoxyphenyl)pent-4-ynoate (PubChem CID 134947165) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is tert-butyl (2R)-2-hydroxy-2-(4-methoxyphenyl)pent-4-ynoate.
| Compound Name | tert-butyl (2R)-2-hydroxy-2-(4-methoxyphenyl)pent-4-ynoate |
|---|---|
| PubChem CID | 134947165 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | tert-butyl (2R)-2-hydroxy-2-(4-methoxyphenyl)pent-4-ynoate |
| SMILES | C#CC[C@](O)(C(=O)OC(C)(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C16H20O4/c1-6-11-16(18,14(17)20-15(2,3)4)12-7-9-13(19-5)10-8-12/h1,7-10,18H,11H2,2-5H3/t16-/m1/s1 |
| InChIKey | MOEDCBMSZRRYOX-MRXNPFEDSA-N |
| XLogP | 2.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|