C19H24O4 — CID 71723933
1-O-tert-butyl 3-O-[(1R)-1-phenylethyl] (2S)-2-methyl-2-prop-2-ynylpropanedioate (PubChem CID 71723933) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-[(1R)-1-phenylethyl] (2S)-2-methyl-2-prop-2-ynylpropanedioate.
| Compound Name | 1-O-tert-butyl 3-O-[(1R)-1-phenylethyl] (2S)-2-methyl-2-prop-2-ynylpropanedioate |
|---|---|
| PubChem CID | 71723933 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 1-O-tert-butyl 3-O-[(1R)-1-phenylethyl] (2S)-2-methyl-2-prop-2-ynylpropanedioate |
| SMILES | C#CC[C@@](C)(C(=O)O[C@H](C)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H24O4/c1-7-13-19(6,17(21)23-18(3,4)5)16(20)22-14(2)15-11-9-8-10-12-15/h1,8-12,14H,13H2,2-6H3/t14-,19+/m1/s1 |
| InChIKey | AGDMQSQMTIBVKF-KUHUBIRLSA-N |
| XLogP | 3.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|