About bis(1-phenylethyl) 2-methyl-2-prop-1-enylpropanedioate
bis(1-phenylethyl) 2-methyl-2-prop-1-enylpropanedioate (PubChem CID 140996033) has the molecular formula C23H26O4
and a molecular weight of 366.46 g/mol. Its IUPAC name is bis(1-phenylethyl) 2-methyl-2-prop-1-enylpropanedioate.
Molecular Properties
| Compound Name | bis(1-phenylethyl) 2-methyl-2-prop-1-enylpropanedioate |
| PubChem CID | 140996033 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | bis(1-phenylethyl) 2-methyl-2-prop-1-enylpropanedioate |
| SMILES | CC=CC(C)(C(=O)OC(C)c1ccccc1)C(=O)OC(C)c1ccccc1 |
| InChI | InChI=1S/C23H26O4/c1-5-16-23(4,21(24)26-17(2)19-12-8-6-9-13-19)22(25)27-18(3)20-14-10-7-11-15-20/h5-18H,1-4H3 |
| InChIKey | UKWYQOINBCYNNF-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis(1-phenylethyl) 2-methyl-2-prop-1-enylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-phenylethyl) 2-methyl-2-prop-1-enylpropanedioate?
The IUPAC name of bis(1-phenylethyl) 2-methyl-2-prop-1-enylpropanedioate (CID 140996033) is bis(1-phenylethyl) 2-methyl-2-prop-1-enylpropanedioate.
What is the SMILES notation for bis(1-phenylethyl) 2-methyl-2-prop-1-enylpropanedioate?
The canonical SMILES for bis(1-phenylethyl) 2-methyl-2-prop-1-enylpropanedioate is CC=CC(C)(C(=O)OC(C)c1ccccc1)C(=O)OC(C)c1ccccc1.
What is the InChIKey of bis(1-phenylethyl) 2-methyl-2-prop-1-enylpropanedioate?
The InChIKey is UKWYQOINBCYNNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26O4/c1-5-16-23(4,21(24)26-17(2)19-12-8-6-9-13-19)22(25)27-18(3)20-14-10-7-11-15-20/h5-18H,1-4H3.
What are the key properties of bis(1-phenylethyl) 2-methyl-2-prop-1-enylpropanedioate?
bis(1-phenylethyl) 2-methyl-2-prop-1-enylpropanedioate has a molecular weight of 366.46 g/mol, XLogP of 5.18, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-phenylethyl) 2-methyl-2-prop-1-enylpropanedioate is sourced from PubChem (CID 140996033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).