About 1-O-benzhydryl 3-O-tert-butyl (2R)-2-benzyl-2-phenylpropanedioate
1-O-benzhydryl 3-O-tert-butyl (2R)-2-benzyl-2-phenylpropanedioate (PubChem CID 53242601) has the molecular formula C33H32O4
and a molecular weight of 492.62 g/mol. Its IUPAC name is 1-O-benzhydryl 3-O-tert-butyl (2R)-2-benzyl-2-phenylpropanedioate.
Molecular Properties
| Compound Name | 1-O-benzhydryl 3-O-tert-butyl (2R)-2-benzyl-2-phenylpropanedioate |
| PubChem CID | 53242601 |
| Molecular Formula | C33H32O4 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | 1-O-benzhydryl 3-O-tert-butyl (2R)-2-benzyl-2-phenylpropanedioate |
| SMILES | CC(C)(C)OC(=O)[C@@](Cc1ccccc1)(C(=O)OC(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H32O4/c1-32(2,3)37-31(35)33(28-22-14-7-15-23-28,24-25-16-8-4-9-17-25)30(34)36-29(26-18-10-5-11-19-26)27-20-12-6-13-21-27/h4-23,29H,24H2,1-3H3/t33-/m1/s1 |
| InChIKey | PHZXZWZPOAHSJM-MGBGTMOVSA-N |
| XLogP | 6.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-O-benzhydryl 3-O-tert-butyl (2R)-2-benzyl-2-phenylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-benzhydryl 3-O-tert-butyl (2R)-2-benzyl-2-phenylpropanedioate?
The IUPAC name of 1-O-benzhydryl 3-O-tert-butyl (2R)-2-benzyl-2-phenylpropanedioate (CID 53242601) is 1-O-benzhydryl 3-O-tert-butyl (2R)-2-benzyl-2-phenylpropanedioate.
What is the SMILES notation for 1-O-benzhydryl 3-O-tert-butyl (2R)-2-benzyl-2-phenylpropanedioate?
The canonical SMILES for 1-O-benzhydryl 3-O-tert-butyl (2R)-2-benzyl-2-phenylpropanedioate is CC(C)(C)OC(=O)[C@@](Cc1ccccc1)(C(=O)OC(c1ccccc1)c1ccccc1)c1ccccc1.
What is the InChIKey of 1-O-benzhydryl 3-O-tert-butyl (2R)-2-benzyl-2-phenylpropanedioate?
The InChIKey is PHZXZWZPOAHSJM-MGBGTMOVSA-N. The full InChI is InChI=1S/C33H32O4/c1-32(2,3)37-31(35)33(28-22-14-7-15-23-28,24-25-16-8-4-9-17-25)30(34)36-29(26-18-10-5-11-19-26)27-20-12-6-13-21-27/h4-23,29H,24H2,1-3H3/t33-/m1/s1.
What are the key properties of 1-O-benzhydryl 3-O-tert-butyl (2R)-2-benzyl-2-phenylpropanedioate?
1-O-benzhydryl 3-O-tert-butyl (2R)-2-benzyl-2-phenylpropanedioate has a molecular weight of 492.62 g/mol, XLogP of 6.84, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-benzhydryl 3-O-tert-butyl (2R)-2-benzyl-2-phenylpropanedioate is sourced from PubChem (CID 53242601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).