C38H42N2O4 — CID 134984846
[1-[(E)-[1-(2,2-dimethylpropanoyloxy)-1,2-diphenylethyl]diazenyl]-1,2-diphenylethyl] 2,2-dimethylpropanoate (PubChem CID 134984846) has the molecular formula C38H42N2O4 and a molecular weight of 590.76 g/mol. Its IUPAC name is [1-[(E)-[1-(2,2-dimethylpropanoyloxy)-1,2-diphenylethyl]diazenyl]-1,2-diphenylethyl] 2,2-dimethylpropanoate.
| Compound Name | [1-[(E)-[1-(2,2-dimethylpropanoyloxy)-1,2-diphenylethyl]diazenyl]-1,2-diphenylethyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134984846 |
| Molecular Formula | C38H42N2O4 |
| Molecular Weight | 590.76 g/mol |
| Exact Mass | 590.31 |
| IUPAC Name | [1-[(E)-[1-(2,2-dimethylpropanoyloxy)-1,2-diphenylethyl]diazenyl]-1,2-diphenylethyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC(Cc1ccccc1)(/N=N/C(Cc1ccccc1)(OC(=O)C(C)(C)C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H42N2O4/c1-35(2,3)33(41)43-37(31-23-15-9-16-24-31,27-29-19-11-7-12-20-29)39-40-38(32-25-17-10-18-26-32,44-34(42)36(4,5)6)28-30-21-13-8-14-22-30/h7-26H,27-28H2,1-6H3/b40-39+ |
| InChIKey | SCWXQOZCYQFVES-XQQUEIPISA-N |
| XLogP | 8.81 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.76 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|