C21H17ClO2 — CID 87256943
1,1,2-triphenylethyl carbonochloridate (PubChem CID 87256943) has the molecular formula C21H17ClO2 and a molecular weight of 336.82 g/mol. Its IUPAC name is 1,1,2-triphenylethyl carbonochloridate.
| Compound Name | 1,1,2-triphenylethyl carbonochloridate |
|---|---|
| PubChem CID | 87256943 |
| Molecular Formula | C21H17ClO2 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 1,1,2-triphenylethyl carbonochloridate |
| SMILES | O=C(Cl)OC(Cc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H17ClO2/c22-20(23)24-21(18-12-6-2-7-13-18,19-14-8-3-9-15-19)16-17-10-4-1-5-11-17/h1-15H,16H2 |
| InChIKey | PKKGWNCVCZRYJH-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|