C28H22O4 — CID 139678861
4-[1-(4-carboxyphenyl)-1,2-diphenylethyl]benzoic acid (PubChem CID 139678861) has the molecular formula C28H22O4 and a molecular weight of 422.48 g/mol. Its IUPAC name is 4-[1-(4-carboxyphenyl)-1,2-diphenylethyl]benzoic acid.
| Compound Name | 4-[1-(4-carboxyphenyl)-1,2-diphenylethyl]benzoic acid |
|---|---|
| PubChem CID | 139678861 |
| Molecular Formula | C28H22O4 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 4-[1-(4-carboxyphenyl)-1,2-diphenylethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(Cc2ccccc2)(c2ccccc2)c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C28H22O4/c29-26(30)21-11-15-24(16-12-21)28(23-9-5-2-6-10-23,19-20-7-3-1-4-8-20)25-17-13-22(14-18-25)27(31)32/h1-18H,19H2,(H,29,30)(H,31,32) |
| InChIKey | JXFCNVSCMKHFDW-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|