C30H26O4 — CID 129294829
4-[[3-[2-(4-carboxyphenyl)-2-phenylpropyl]phenyl]methyl]benzoic acid (PubChem CID 129294829) has the molecular formula C30H26O4 and a molecular weight of 450.53 g/mol. Its IUPAC name is 4-[[3-[2-(4-carboxyphenyl)-2-phenylpropyl]phenyl]methyl]benzoic acid.
| Compound Name | 4-[[3-[2-(4-carboxyphenyl)-2-phenylpropyl]phenyl]methyl]benzoic acid |
|---|---|
| PubChem CID | 129294829 |
| Molecular Formula | C30H26O4 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 4-[[3-[2-(4-carboxyphenyl)-2-phenylpropyl]phenyl]methyl]benzoic acid |
| SMILES | CC(Cc1cccc(Cc2ccc(C(=O)O)cc2)c1)(c1ccccc1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C30H26O4/c1-30(26-8-3-2-4-9-26,27-16-14-25(15-17-27)29(33)34)20-23-7-5-6-22(19-23)18-21-10-12-24(13-11-21)28(31)32/h2-17,19H,18,20H2,1H3,(H,31,32)(H,33,34) |
| InChIKey | UEEHGSITURXADH-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |