C25H25NaO3 — CID 23670640
sodium 2-(4-benzylphenoxy)-3-(3-ethylphenyl)-2-methylpropanoate (PubChem CID 23670640) has the molecular formula C25H25NaO3 and a molecular weight of 396.46 g/mol. Its IUPAC name is sodium 2-(4-benzylphenoxy)-3-(3-ethylphenyl)-2-methylpropanoate.
| Compound Name | sodium 2-(4-benzylphenoxy)-3-(3-ethylphenyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 23670640 |
| Molecular Formula | C25H25NaO3 |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | sodium 2-(4-benzylphenoxy)-3-(3-ethylphenyl)-2-methylpropanoate |
| SMILES | CCc1cccc(CC(C)(Oc2ccc(Cc3ccccc3)cc2)C(=O)[O-])c1.[Na+] |
| InChI | InChI=1S/C25H26O3.Na/c1-3-19-10-7-11-22(16-19)18-25(2,24(26)27)28-23-14-12-21(13-15-23)17-20-8-5-4-6-9-20;/h4-16H,3,17-18H2,1-2H3,(H,26,27);/q;+1/p-1 |
| InChIKey | ZYPMCSAHDGSGKF-UHFFFAOYSA-M |
| XLogP | 0.97 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |