C18H18ClNaO3 — CID 141244068
sodium 2-[3-[(4-chlorophenyl)methyl]phenoxy]-2-methylbutanoate (PubChem CID 141244068) has the molecular formula C18H18ClNaO3 and a molecular weight of 340.78 g/mol. Its IUPAC name is sodium 2-[3-[(4-chlorophenyl)methyl]phenoxy]-2-methylbutanoate.
| Compound Name | sodium 2-[3-[(4-chlorophenyl)methyl]phenoxy]-2-methylbutanoate |
|---|---|
| PubChem CID | 141244068 |
| Molecular Formula | C18H18ClNaO3 |
| Molecular Weight | 340.78 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | sodium 2-[3-[(4-chlorophenyl)methyl]phenoxy]-2-methylbutanoate |
| SMILES | CCC(C)(Oc1cccc(Cc2ccc(Cl)cc2)c1)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C18H19ClO3.Na/c1-3-18(2,17(20)21)22-16-6-4-5-14(12-16)11-13-7-9-15(19)10-8-13;/h4-10,12H,3,11H2,1-2H3,(H,20,21);/q;+1/p-1 |
| InChIKey | WSXMADMMQXRRGK-UHFFFAOYSA-M |
| XLogP | 0.23 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.78 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |