C28H36O6 — CID 10695604
tert-butyl [(1R,5R)-3-methylidene-5-[(2-methylpropan-2-yl)oxycarbonyloxy]-1,5-diphenylpentyl] carbonate (PubChem CID 10695604) has the molecular formula C28H36O6 and a molecular weight of 468.59 g/mol. Its IUPAC name is tert-butyl [(1R,5R)-3-methylidene-5-[(2-methylpropan-2-yl)oxycarbonyloxy]-1,5-diphenylpentyl] carbonate.
| Compound Name | tert-butyl [(1R,5R)-3-methylidene-5-[(2-methylpropan-2-yl)oxycarbonyloxy]-1,5-diphenylpentyl] carbonate |
|---|---|
| PubChem CID | 10695604 |
| Molecular Formula | C28H36O6 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | tert-butyl [(1R,5R)-3-methylidene-5-[(2-methylpropan-2-yl)oxycarbonyloxy]-1,5-diphenylpentyl] carbonate |
| SMILES | C=C(C[C@@H](OC(=O)OC(C)(C)C)c1ccccc1)C[C@@H](OC(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C28H36O6/c1-20(18-23(21-14-10-8-11-15-21)31-25(29)33-27(2,3)4)19-24(22-16-12-9-13-17-22)32-26(30)34-28(5,6)7/h8-17,23-24H,1,18-19H2,2-7H3/t23-,24-/m1/s1 |
| InChIKey | VGBPSDMEWHZSJF-DNQXCXABSA-N |
| XLogP | 7.71 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|