C20H27F3O8S — CID 118686428
tert-butyl (2,2,2-trifluoro-1-phenylethyl) carbonate;3-(2-methylprop-2-enoyloxy)propane-1-sulfonic acid (PubChem CID 118686428) has the molecular formula C20H27F3O8S and a molecular weight of 484.49 g/mol. Its IUPAC name is tert-butyl (2,2,2-trifluoro-1-phenylethyl) carbonate;3-(2-methylprop-2-enoyloxy)propane-1-sulfonic acid.
| Compound Name | tert-butyl (2,2,2-trifluoro-1-phenylethyl) carbonate;3-(2-methylprop-2-enoyloxy)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 118686428 |
| Molecular Formula | C20H27F3O8S |
| Molecular Weight | 484.49 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | tert-butyl (2,2,2-trifluoro-1-phenylethyl) carbonate;3-(2-methylprop-2-enoyloxy)propane-1-sulfonic acid |
| SMILES | C=C(C)C(=O)OCCCS(=O)(=O)O.CC(C)(C)OC(=O)OC(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H15F3O3.C7H12O5S/c1-12(2,3)19-11(17)18-10(13(14,15)16)9-7-5-4-6-8-9;1-6(2)7(8)12-4-3-5-13(9,10)11/h4-8,10H,1-3H3;1,3-5H2,2H3,(H,9,10,11) |
| InChIKey | FWSMZGQOFWUVJD-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|