C25H36N2O4 — CID 173310727
tert-butyl N-[2-hydroxy-1-[(3-hydroxy-1-phenylbutan-2-yl)amino]-4-phenylbutyl]carbamate (PubChem CID 173310727) has the molecular formula C25H36N2O4 and a molecular weight of 428.57 g/mol. Its IUPAC name is tert-butyl N-[2-hydroxy-1-[(3-hydroxy-1-phenylbutan-2-yl)amino]-4-phenylbutyl]carbamate.
| Compound Name | tert-butyl N-[2-hydroxy-1-[(3-hydroxy-1-phenylbutan-2-yl)amino]-4-phenylbutyl]carbamate |
|---|---|
| PubChem CID | 173310727 |
| Molecular Formula | C25H36N2O4 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | tert-butyl N-[2-hydroxy-1-[(3-hydroxy-1-phenylbutan-2-yl)amino]-4-phenylbutyl]carbamate |
| SMILES | CC(O)C(Cc1ccccc1)NC(NC(=O)OC(C)(C)C)C(O)CCc1ccccc1 |
| InChI | InChI=1S/C25H36N2O4/c1-18(28)21(17-20-13-9-6-10-14-20)26-23(27-24(30)31-25(2,3)4)22(29)16-15-19-11-7-5-8-12-19/h5-14,18,21-23,26,28-29H,15-17H2,1-4H3,(H,27,30) |
| InChIKey | JOXLQYCKQVCLQX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|