C23H29F2NO3 — CID 22846097
tert-butyl N-[(2S,3R)-4,4-difluoro-3-hydroxy-1,6-diphenylhexan-2-yl]carbamate (PubChem CID 22846097) has the molecular formula C23H29F2NO3 and a molecular weight of 405.49 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-4,4-difluoro-3-hydroxy-1,6-diphenylhexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-4,4-difluoro-3-hydroxy-1,6-diphenylhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 22846097 |
| Molecular Formula | C23H29F2NO3 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | tert-butyl N-[(2S,3R)-4,4-difluoro-3-hydroxy-1,6-diphenylhexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)[C@@H](O)C(F)(F)CCc1ccccc1 |
| InChI | InChI=1S/C23H29F2NO3/c1-22(2,3)29-21(28)26-19(16-18-12-8-5-9-13-18)20(27)23(24,25)15-14-17-10-6-4-7-11-17/h4-13,19-20,27H,14-16H2,1-3H3,(H,26,28)/t19-,20+/m0/s1 |
| InChIKey | DSTGDLDHKJWCGN-VQTJNVASSA-N |
| XLogP | 4.75 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |