C19H28F2O3Si — CID 52921122
methyl (Z)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-difluoro-3-methyl-5-phenylpent-2-enoate (PubChem CID 52921122) has the molecular formula C19H28F2O3Si and a molecular weight of 370.51 g/mol. Its IUPAC name is methyl (Z)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-difluoro-3-methyl-5-phenylpent-2-enoate.
| Compound Name | methyl (Z)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-difluoro-3-methyl-5-phenylpent-2-enoate |
|---|---|
| PubChem CID | 52921122 |
| Molecular Formula | C19H28F2O3Si |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | methyl (Z)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-difluoro-3-methyl-5-phenylpent-2-enoate |
| SMILES | COC(=O)/C=C(/C)C(F)(F)C(O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H28F2O3Si/c1-14(13-16(22)23-5)19(20,21)17(15-11-9-8-10-12-15)24-25(6,7)18(2,3)4/h8-13,17H,1-7H3/b14-13- |
| InChIKey | DMILVZFSKXMWNC-YPKPFQOOSA-N |
| XLogP | 5.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|