C22H34N2O4Si — CID 67068499
ethyl 3-[[2-[tert-butyl(dimethyl)silyl]oxy-2-(4-methoxyphenyl)ethyl]amino]-1H-pyrrole-2-carboxylate (PubChem CID 67068499) has the molecular formula C22H34N2O4Si and a molecular weight of 418.61 g/mol. Its IUPAC name is ethyl 3-[[2-[tert-butyl(dimethyl)silyl]oxy-2-(4-methoxyphenyl)ethyl]amino]-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3-[[2-[tert-butyl(dimethyl)silyl]oxy-2-(4-methoxyphenyl)ethyl]amino]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 67068499 |
| Molecular Formula | C22H34N2O4Si |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | ethyl 3-[[2-[tert-butyl(dimethyl)silyl]oxy-2-(4-methoxyphenyl)ethyl]amino]-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]ccc1NCC(O[Si](C)(C)C(C)(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H34N2O4Si/c1-8-27-21(25)20-18(13-14-23-20)24-15-19(28-29(6,7)22(2,3)4)16-9-11-17(26-5)12-10-16/h9-14,19,23-24H,8,15H2,1-7H3 |
| InChIKey | CYFBVNOISGURAT-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|