C24H36N2O7SSi — CID 54037955
2-[[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]-2-(4-methoxyphenyl)acetic acid (PubChem CID 54037955) has the molecular formula C24H36N2O7SSi and a molecular weight of 524.71 g/mol. Its IUPAC name is 2-[[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]-2-(4-methoxyphenyl)acetic acid.
| Compound Name | 2-[[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]-2-(4-methoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 54037955 |
| Molecular Formula | C24H36N2O7SSi |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | 2-[[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]-2-(4-methoxyphenyl)acetic acid |
| SMILES | COc1ccc(C(NC[C@@H](O[Si](C)(C)C(C)(C)C)c2ccc(O)c(NS(C)(=O)=O)c2)C(=O)O)cc1 |
| InChI | InChI=1S/C24H36N2O7SSi/c1-24(2,3)35(6,7)33-21(17-10-13-20(27)19(14-17)26-34(5,30)31)15-25-22(23(28)29)16-8-11-18(32-4)12-9-16/h8-14,21-22,25-27H,15H2,1-7H3,(H,28,29)/t21-,22?/m1/s1 |
| InChIKey | LKHQKUOZLSBBGQ-ZMFCMNQTSA-N |
| XLogP | 4.25 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|