C8H11N3O3 — CID 55266586
ethyl 3-(carbamoylamino)-1H-pyrrole-2-carboxylate (PubChem CID 55266586) has the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. Its IUPAC name is ethyl 3-(carbamoylamino)-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3-(carbamoylamino)-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 55266586 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | ethyl 3-(carbamoylamino)-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]ccc1NC(N)=O |
| InChI | InChI=1S/C8H11N3O3/c1-2-14-7(12)6-5(3-4-10-6)11-8(9)13/h3-4,10H,2H2,1H3,(H3,9,11,13) |
| InChIKey | NHGFTGKSZXSNNW-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |