C15H15FN2O3 — CID 67052946
ethyl 3-[[2-(4-fluorophenyl)acetyl]amino]-1H-pyrrole-2-carboxylate (PubChem CID 67052946) has the molecular formula C15H15FN2O3 and a molecular weight of 290.29 g/mol. Its IUPAC name is ethyl 3-[[2-(4-fluorophenyl)acetyl]amino]-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3-[[2-(4-fluorophenyl)acetyl]amino]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 67052946 |
| Molecular Formula | C15H15FN2O3 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | ethyl 3-[[2-(4-fluorophenyl)acetyl]amino]-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]ccc1NC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C15H15FN2O3/c1-2-21-15(20)14-12(7-8-17-14)18-13(19)9-10-3-5-11(16)6-4-10/h3-8,17H,2,9H2,1H3,(H,18,19) |
| InChIKey | TYCDEISKGMAPED-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |