C14H15BrN2O2 — CID 169089668
ethyl 3-[(2-bromophenyl)methylamino]-1H-pyrrole-2-carboxylate (PubChem CID 169089668) has the molecular formula C14H15BrN2O2 and a molecular weight of 323.19 g/mol. Its IUPAC name is ethyl 3-[(2-bromophenyl)methylamino]-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3-[(2-bromophenyl)methylamino]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 169089668 |
| Molecular Formula | C14H15BrN2O2 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | ethyl 3-[(2-bromophenyl)methylamino]-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]ccc1NCc1ccccc1Br |
| InChI | InChI=1S/C14H15BrN2O2/c1-2-19-14(18)13-12(7-8-16-13)17-9-10-5-3-4-6-11(10)15/h3-8,16-17H,2,9H2,1H3 |
| InChIKey | QBCVAOFXCKJSAX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |