C18H24N4O2 — CID 176898732
ethyl 3-[(2-piperidin-2-yl-3-pyridinyl)methylamino]-1H-pyrrole-2-carboxylate (PubChem CID 176898732) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is ethyl 3-[(2-piperidin-2-yl-3-pyridinyl)methylamino]-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3-[(2-piperidin-2-yl-3-pyridinyl)methylamino]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 176898732 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | ethyl 3-[(2-piperidin-2-yl-3-pyridinyl)methylamino]-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]ccc1NCc1cccnc1C1CCCCN1 |
| InChI | InChI=1S/C18H24N4O2/c1-2-24-18(23)17-15(8-11-21-17)22-12-13-6-5-10-20-16(13)14-7-3-4-9-19-14/h5-6,8,10-11,14,19,21-22H,2-4,7,9,12H2,1H3 |
| InChIKey | QLSCUEJOBYRTNF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |