C14H19F3N2O3 — CID 166517032
ethyl 3-[2-[1-(trifluoromethyl)cyclobutyl]oxyethylamino]-1H-pyrrole-2-carboxylate (PubChem CID 166517032) has the molecular formula C14H19F3N2O3 and a molecular weight of 320.31 g/mol. Its IUPAC name is ethyl 3-[2-[1-(trifluoromethyl)cyclobutyl]oxyethylamino]-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3-[2-[1-(trifluoromethyl)cyclobutyl]oxyethylamino]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 166517032 |
| Molecular Formula | C14H19F3N2O3 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | ethyl 3-[2-[1-(trifluoromethyl)cyclobutyl]oxyethylamino]-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]ccc1NCCOC1(C(F)(F)F)CCC1 |
| InChI | InChI=1S/C14H19F3N2O3/c1-2-21-12(20)11-10(4-7-19-11)18-8-9-22-13(5-3-6-13)14(15,16)17/h4,7,18-19H,2-3,5-6,8-9H2,1H3 |
| InChIKey | PDOUGGDWVILPPU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|