C21H23N3O4 — CID 166422294
ethyl 3-[[4-(1-prop-2-enoylpyrrolidin-2-yl)benzoyl]amino]-1H-pyrrole-2-carboxylate (PubChem CID 166422294) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is ethyl 3-[[4-(1-prop-2-enoylpyrrolidin-2-yl)benzoyl]amino]-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3-[[4-(1-prop-2-enoylpyrrolidin-2-yl)benzoyl]amino]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 166422294 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | ethyl 3-[[4-(1-prop-2-enoylpyrrolidin-2-yl)benzoyl]amino]-1H-pyrrole-2-carboxylate |
| SMILES | C=CC(=O)N1CCCC1c1ccc(C(=O)Nc2cc[nH]c2C(=O)OCC)cc1 |
| InChI | InChI=1S/C21H23N3O4/c1-3-18(25)24-13-5-6-17(24)14-7-9-15(10-8-14)20(26)23-16-11-12-22-19(16)21(27)28-4-2/h3,7-12,17,22H,1,4-6,13H2,2H3,(H,23,26) |
| InChIKey | KJWJBUSLYHDYOV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|