C21H30N2O2 — CID 166422286
N-(5-methylhexan-2-yl)-4-(1-prop-2-enoylpyrrolidin-2-yl)benzamide (PubChem CID 166422286) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is N-(5-methylhexan-2-yl)-4-(1-prop-2-enoylpyrrolidin-2-yl)benzamide.
| Compound Name | N-(5-methylhexan-2-yl)-4-(1-prop-2-enoylpyrrolidin-2-yl)benzamide |
|---|---|
| PubChem CID | 166422286 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | N-(5-methylhexan-2-yl)-4-(1-prop-2-enoylpyrrolidin-2-yl)benzamide |
| SMILES | C=CC(=O)N1CCCC1c1ccc(C(=O)NC(C)CCC(C)C)cc1 |
| InChI | InChI=1S/C21H30N2O2/c1-5-20(24)23-14-6-7-19(23)17-10-12-18(13-11-17)21(25)22-16(4)9-8-15(2)3/h5,10-13,15-16,19H,1,6-9,14H2,2-4H3,(H,22,25) |
| InChIKey | UFHDWLGNSNINNJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|