C15H20O3 — CID 102215273
(E,1S)-1-hydroxy-1-(4-methoxyphenyl)oct-4-en-3-one (PubChem CID 102215273) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (E,1S)-1-hydroxy-1-(4-methoxyphenyl)oct-4-en-3-one.
| Compound Name | (E,1S)-1-hydroxy-1-(4-methoxyphenyl)oct-4-en-3-one |
|---|---|
| PubChem CID | 102215273 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (E,1S)-1-hydroxy-1-(4-methoxyphenyl)oct-4-en-3-one |
| SMILES | CCC/C=C/C(=O)C[C@H](O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C15H20O3/c1-3-4-5-6-13(16)11-15(17)12-7-9-14(18-2)10-8-12/h5-10,15,17H,3-4,11H2,1-2H3/b6-5+/t15-/m0/s1 |
| InChIKey | AYGPGJFFDMASBQ-NFAHFFEMSA-N |
| XLogP | 3.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|