C16H24O5Si — CID 134930629
methyl (Z,5S)-5-hydroxy-5-(4-methoxyphenyl)-3-trimethylsilyloxypent-2-enoate (PubChem CID 134930629) has the molecular formula C16H24O5Si and a molecular weight of 324.45 g/mol. Its IUPAC name is methyl (Z,5S)-5-hydroxy-5-(4-methoxyphenyl)-3-trimethylsilyloxypent-2-enoate.
| Compound Name | methyl (Z,5S)-5-hydroxy-5-(4-methoxyphenyl)-3-trimethylsilyloxypent-2-enoate |
|---|---|
| PubChem CID | 134930629 |
| Molecular Formula | C16H24O5Si |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | methyl (Z,5S)-5-hydroxy-5-(4-methoxyphenyl)-3-trimethylsilyloxypent-2-enoate |
| SMILES | COC(=O)/C=C(/C[C@H](O)c1ccc(OC)cc1)O[Si](C)(C)C |
| InChI | InChI=1S/C16H24O5Si/c1-19-13-8-6-12(7-9-13)15(17)10-14(11-16(18)20-2)21-22(3,4)5/h6-9,11,15,17H,10H2,1-5H3/b14-11-/t15-/m0/s1 |
| InChIKey | IOFDAKSOEYVLQW-SZGZABIGSA-N |
| XLogP | 3.03 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|