C25H37NO5Si — CID 102019355
ethyl 2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-[(4-methoxyphenyl)iminomethyl]-1-methyl-4-oxocyclobut-2-ene-1-carboxylate (PubChem CID 102019355) has the molecular formula C25H37NO5Si and a molecular weight of 459.66 g/mol. Its IUPAC name is ethyl 2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-[(4-methoxyphenyl)iminomethyl]-1-methyl-4-oxocyclobut-2-ene-1-carboxylate.
| Compound Name | ethyl 2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-[(4-methoxyphenyl)iminomethyl]-1-methyl-4-oxocyclobut-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 102019355 |
| Molecular Formula | C25H37NO5Si |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | ethyl 2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-[(4-methoxyphenyl)iminomethyl]-1-methyl-4-oxocyclobut-2-ene-1-carboxylate |
| SMILES | CCOC(=O)C1(C)C(=O)C(/C=N/c2ccc(OC)cc2)=C1CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H37NO5Si/c1-9-30-23(28)25(5)21(11-10-16-31-32(7,8)24(2,3)4)20(22(25)27)17-26-18-12-14-19(29-6)15-13-18/h12-15,17H,9-11,16H2,1-8H3/b26-17+ |
| InChIKey | SVGGGTRNLWTTDE-YZSQISJMSA-N |
| XLogP | 5.65 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|