C15H34F2NO4PSi — CID 10786574
(2S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-4-diethoxyphosphoryl-4,4-difluoro-3-methylbutan-2-amine (PubChem CID 10786574) has the molecular formula C15H34F2NO4PSi and a molecular weight of 389.50 g/mol. Its IUPAC name is (2S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-4-diethoxyphosphoryl-4,4-difluoro-3-methylbutan-2-amine.
| Compound Name | (2S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-4-diethoxyphosphoryl-4,4-difluoro-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 10786574 |
| Molecular Formula | C15H34F2NO4PSi |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | (2S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-4-diethoxyphosphoryl-4,4-difluoro-3-methylbutan-2-amine |
| SMILES | CCOP(=O)(OCC)C(F)(F)[C@H](C)[C@H](N)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H34F2NO4PSi/c1-9-20-23(19,21-10-2)15(16,17)12(3)13(18)11-22-24(7,8)14(4,5)6/h12-13H,9-11,18H2,1-8H3/t12-,13-/m1/s1 |
| InChIKey | SFDKMOMUVVYDRQ-CHWSQXEVSA-N |
| XLogP | 4.83 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|