C20H35N3O3Si — CID 10883732
[(2R,3S)-3-azido-2-(1-ethoxyethoxy)-4-phenylbutoxy]-tert-butyl-dimethylsilane (PubChem CID 10883732) has the molecular formula C20H35N3O3Si and a molecular weight of 393.60 g/mol. Its IUPAC name is [(2R,3S)-3-azido-2-(1-ethoxyethoxy)-4-phenylbutoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3S)-3-azido-2-(1-ethoxyethoxy)-4-phenylbutoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10883732 |
| Molecular Formula | C20H35N3O3Si |
| Molecular Weight | 393.60 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | [(2R,3S)-3-azido-2-(1-ethoxyethoxy)-4-phenylbutoxy]-tert-butyl-dimethylsilane |
| SMILES | CCOC(C)O[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](Cc1ccccc1)N=[N+]=[N-] |
| InChI | InChI=1S/C20H35N3O3Si/c1-8-24-16(2)26-19(15-25-27(6,7)20(3,4)5)18(22-23-21)14-17-12-10-9-11-13-17/h9-13,16,18-19H,8,14-15H2,1-7H3/t16?,18-,19-/m0/s1 |
| InChIKey | ABLSIRDJISNNQV-MSYFUGIWSA-N |
| XLogP | 5.70 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.60 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|