C21H35N3O7SSi — CID 10983934
[(2R,3S,4R)-4-azido-1-[tert-butyl(dimethyl)silyl]oxy-5-(4-methoxyphenyl)-2-methylsulfonyloxypentan-3-yl] acetate (PubChem CID 10983934) has the molecular formula C21H35N3O7SSi and a molecular weight of 501.68 g/mol. Its IUPAC name is [(2R,3S,4R)-4-azido-1-[tert-butyl(dimethyl)silyl]oxy-5-(4-methoxyphenyl)-2-methylsulfonyloxypentan-3-yl] acetate.
| Compound Name | [(2R,3S,4R)-4-azido-1-[tert-butyl(dimethyl)silyl]oxy-5-(4-methoxyphenyl)-2-methylsulfonyloxypentan-3-yl] acetate |
|---|---|
| PubChem CID | 10983934 |
| Molecular Formula | C21H35N3O7SSi |
| Molecular Weight | 501.68 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | [(2R,3S,4R)-4-azido-1-[tert-butyl(dimethyl)silyl]oxy-5-(4-methoxyphenyl)-2-methylsulfonyloxypentan-3-yl] acetate |
| SMILES | COc1ccc(C[C@@H](N=[N+]=[N-])[C@H](OC(C)=O)[C@@H](CO[Si](C)(C)C(C)(C)C)OS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H35N3O7SSi/c1-15(25)30-20(18(23-24-22)13-16-9-11-17(28-5)12-10-16)19(31-32(6,26)27)14-29-33(7,8)21(2,3)4/h9-12,18-20H,13-14H2,1-8H3/t18-,19-,20+/m1/s1 |
| InChIKey | BIVDWFODIWEGNA-AQNXPRMDSA-N |
| XLogP | 4.21 |
| TPSA | 136.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.68 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|