C15H19N3O4 — CID 23241033
[(1S,2R)-2-azido-3-(4-methoxyphenyl)-1-[(2S)-oxiran-2-yl]propyl] propanoate (PubChem CID 23241033) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is [(1S,2R)-2-azido-3-(4-methoxyphenyl)-1-[(2S)-oxiran-2-yl]propyl] propanoate.
| Compound Name | [(1S,2R)-2-azido-3-(4-methoxyphenyl)-1-[(2S)-oxiran-2-yl]propyl] propanoate |
|---|---|
| PubChem CID | 23241033 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | [(1S,2R)-2-azido-3-(4-methoxyphenyl)-1-[(2S)-oxiran-2-yl]propyl] propanoate |
| SMILES | CCC(=O)O[C@H]([C@@H]1CO1)[C@@H](Cc1ccc(OC)cc1)N=[N+]=[N-] |
| InChI | InChI=1S/C15H19N3O4/c1-3-14(19)22-15(13-9-21-13)12(17-18-16)8-10-4-6-11(20-2)7-5-10/h4-7,12-13,15H,3,8-9H2,1-2H3/t12-,13+,15+/m1/s1 |
| InChIKey | VQEBJYIVOBEDQT-IPYPFGDCSA-N |
| XLogP | 2.64 |
| TPSA | 96.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|