C22H49N3O7P2Si — CID 171086957
[4-azido-1,1-bis(diethoxyphosphoryl)-2,2-diethylbutoxy]-tert-butyl-dimethylsilane (PubChem CID 171086957) has the molecular formula C22H49N3O7P2Si and a molecular weight of 557.68 g/mol. Its IUPAC name is [4-azido-1,1-bis(diethoxyphosphoryl)-2,2-diethylbutoxy]-tert-butyl-dimethylsilane.
| Compound Name | [4-azido-1,1-bis(diethoxyphosphoryl)-2,2-diethylbutoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 171086957 |
| Molecular Formula | C22H49N3O7P2Si |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | [4-azido-1,1-bis(diethoxyphosphoryl)-2,2-diethylbutoxy]-tert-butyl-dimethylsilane |
| SMILES | CCOP(=O)(OCC)C(O[Si](C)(C)C(C)(C)C)(C(CC)(CC)CCN=[N+]=[N-])P(=O)(OCC)OCC |
| InChI | InChI=1S/C22H49N3O7P2Si/c1-12-21(13-2,18-19-24-25-23)22(32-35(10,11)20(7,8)9,33(26,28-14-3)29-15-4)34(27,30-16-5)31-17-6/h12-19H2,1-11H3 |
| InChIKey | KIDNBZZYAPVJGX-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 129.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|