C13H23N5O2Si — CID 90968003
[2-azido-2-(2-methoxypyrimidin-5-yl)ethoxy]-tert-butyl-dimethylsilane (PubChem CID 90968003) has the molecular formula C13H23N5O2Si and a molecular weight of 309.45 g/mol. Its IUPAC name is [2-azido-2-(2-methoxypyrimidin-5-yl)ethoxy]-tert-butyl-dimethylsilane.
| Compound Name | [2-azido-2-(2-methoxypyrimidin-5-yl)ethoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 90968003 |
| Molecular Formula | C13H23N5O2Si |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | [2-azido-2-(2-methoxypyrimidin-5-yl)ethoxy]-tert-butyl-dimethylsilane |
| SMILES | COc1ncc(C(CO[Si](C)(C)C(C)(C)C)N=[N+]=[N-])cn1 |
| InChI | InChI=1S/C13H23N5O2Si/c1-13(2,3)21(5,6)20-9-11(17-18-14)10-7-15-12(19-4)16-8-10/h7-8,11H,9H2,1-6H3 |
| InChIKey | JUJULGVMIJCCEL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 93.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|