C18H32O5Si — CID 135068796
tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-3-(furan-2-yl)-3-hydroxybutanoate (PubChem CID 135068796) has the molecular formula C18H32O5Si and a molecular weight of 356.54 g/mol. Its IUPAC name is tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-3-(furan-2-yl)-3-hydroxybutanoate.
| Compound Name | tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-3-(furan-2-yl)-3-hydroxybutanoate |
|---|---|
| PubChem CID | 135068796 |
| Molecular Formula | C18H32O5Si |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-3-(furan-2-yl)-3-hydroxybutanoate |
| SMILES | CC(C)(C)OC(=O)C(O[Si](C)(C)C(C)(C)C)C(C)(O)c1ccco1 |
| InChI | InChI=1S/C18H32O5Si/c1-16(2,3)22-15(19)14(23-24(8,9)17(4,5)6)18(7,20)13-11-10-12-21-13/h10-12,14,20H,1-9H3 |
| InChIKey | BPWNDDSTHLDDRI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|