C12H19NO3 — CID 103773961
tert-butyl (2R)-2-(furan-2-ylmethylamino)propanoate (PubChem CID 103773961) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is tert-butyl (2R)-2-(furan-2-ylmethylamino)propanoate.
| Compound Name | tert-butyl (2R)-2-(furan-2-ylmethylamino)propanoate |
|---|---|
| PubChem CID | 103773961 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | tert-butyl (2R)-2-(furan-2-ylmethylamino)propanoate |
| SMILES | C[C@@H](NCc1ccco1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H19NO3/c1-9(11(14)16-12(2,3)4)13-8-10-6-5-7-15-10/h5-7,9,13H,8H2,1-4H3/t9-/m1/s1 |
| InChIKey | VHDIJBNURYHTNR-SECBINFHSA-N |
| XLogP | 2.10 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |