C19H31NO2 — CID 71192096
tert-butyl 2-[[4-(2-methylbutan-2-yl)phenyl]methylamino]propanoate (PubChem CID 71192096) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is tert-butyl 2-[[4-(2-methylbutan-2-yl)phenyl]methylamino]propanoate.
| Compound Name | tert-butyl 2-[[4-(2-methylbutan-2-yl)phenyl]methylamino]propanoate |
|---|---|
| PubChem CID | 71192096 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | tert-butyl 2-[[4-(2-methylbutan-2-yl)phenyl]methylamino]propanoate |
| SMILES | CCC(C)(C)c1ccc(CNC(C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H31NO2/c1-8-19(6,7)16-11-9-15(10-12-16)13-20-14(2)17(21)22-18(3,4)5/h9-12,14,20H,8,13H2,1-7H3 |
| InChIKey | MUYPUHOJSYQCKT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |