C11H18O3 — CID 162405799
2-[1-(furan-2-yl)pentoxy]ethanol (PubChem CID 162405799) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is 2-[1-(furan-2-yl)pentoxy]ethanol.
| Compound Name | 2-[1-(furan-2-yl)pentoxy]ethanol |
|---|---|
| PubChem CID | 162405799 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 2-[1-(furan-2-yl)pentoxy]ethanol |
| SMILES | CCCCC(OCCO)c1ccco1 |
| InChI | InChI=1S/C11H18O3/c1-2-3-5-10(14-9-7-12)11-6-4-8-13-11/h4,6,8,10,12H,2-3,5,7,9H2,1H3 |
| InChIKey | HIVFXFSTVXKRFM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |