About 2-(dipropoxymethyl)furan
2-(dipropoxymethyl)furan (PubChem CID 14296431) has the molecular formula C11H18O3
and a molecular weight of 198.26 g/mol. Its IUPAC name is 2-(dipropoxymethyl)furan.
Molecular Properties
| Compound Name | 2-(dipropoxymethyl)furan |
| PubChem CID | 14296431 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 2-(dipropoxymethyl)furan |
| SMILES | CCCOC(OCCC)c1ccco1 |
| InChI | InChI=1S/C11H18O3/c1-3-7-13-11(14-8-4-2)10-6-5-9-12-10/h5-6,9,11H,3-4,7-8H2,1-2H3 |
| InChIKey | SPTCCXLHXZTKOQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(dipropoxymethyl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dipropoxymethyl)furan?
The IUPAC name of 2-(dipropoxymethyl)furan (CID 14296431) is 2-(dipropoxymethyl)furan.
What is the SMILES notation for 2-(dipropoxymethyl)furan?
The canonical SMILES for 2-(dipropoxymethyl)furan is CCCOC(OCCC)c1ccco1.
What is the InChIKey of 2-(dipropoxymethyl)furan?
The InChIKey is SPTCCXLHXZTKOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O3/c1-3-7-13-11(14-8-4-2)10-6-5-9-12-10/h5-6,9,11H,3-4,7-8H2,1-2H3.
What are the key properties of 2-(dipropoxymethyl)furan?
2-(dipropoxymethyl)furan has a molecular weight of 198.26 g/mol, XLogP of 3.13, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dipropoxymethyl)furan is sourced from PubChem (CID 14296431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).