C11H19NO3 — CID 79493173
N-[1-(furan-2-yl)-2,2-dimethoxyethyl]propan-1-amine (PubChem CID 79493173) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is N-[1-(furan-2-yl)-2,2-dimethoxyethyl]propan-1-amine.
| Compound Name | N-[1-(furan-2-yl)-2,2-dimethoxyethyl]propan-1-amine |
|---|---|
| PubChem CID | 79493173 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | N-[1-(furan-2-yl)-2,2-dimethoxyethyl]propan-1-amine |
| SMILES | CCCNC(c1ccco1)C(OC)OC |
| InChI | InChI=1S/C11H19NO3/c1-4-7-12-10(11(13-2)14-3)9-6-5-8-15-9/h5-6,8,10-12H,4,7H2,1-3H3 |
| InChIKey | VDPKGOBLAFOVCA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|