C17H30O5Si — CID 11782841
2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl]-6-methoxy-3,5-dimethylpyran-4-one (PubChem CID 11782841) has the molecular formula C17H30O5Si and a molecular weight of 342.51 g/mol. Its IUPAC name is 2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl]-6-methoxy-3,5-dimethylpyran-4-one.
| Compound Name | 2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl]-6-methoxy-3,5-dimethylpyran-4-one |
|---|---|
| PubChem CID | 11782841 |
| Molecular Formula | C17H30O5Si |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl]-6-methoxy-3,5-dimethylpyran-4-one |
| SMILES | COc1oc([C@@H](CCO)O[Si](C)(C)C(C)(C)C)c(C)c(=O)c1C |
| InChI | InChI=1S/C17H30O5Si/c1-11-14(19)12(2)16(20-6)21-15(11)13(9-10-18)22-23(7,8)17(3,4)5/h13,18H,9-10H2,1-8H3/t13-/m1/s1 |
| InChIKey | OQQVFBVLTHJAHM-CYBMUJFWSA-N |
| XLogP | 3.71 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|