C18H30FNOSi — CID 140530647
(1S)-1-cyclopropyl-1-(3-fluorophenyl)-4-methyl-2-trimethylsilyloxypentan-3-amine (PubChem CID 140530647) has the molecular formula C18H30FNOSi and a molecular weight of 323.53 g/mol. Its IUPAC name is (1S)-1-cyclopropyl-1-(3-fluorophenyl)-4-methyl-2-trimethylsilyloxypentan-3-amine.
| Compound Name | (1S)-1-cyclopropyl-1-(3-fluorophenyl)-4-methyl-2-trimethylsilyloxypentan-3-amine |
|---|---|
| PubChem CID | 140530647 |
| Molecular Formula | C18H30FNOSi |
| Molecular Weight | 323.53 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | (1S)-1-cyclopropyl-1-(3-fluorophenyl)-4-methyl-2-trimethylsilyloxypentan-3-amine |
| SMILES | CC(C)C(N)C(O[Si](C)(C)C)[C@H](c1cccc(F)c1)C1CC1 |
| InChI | InChI=1S/C18H30FNOSi/c1-12(2)17(20)18(21-22(3,4)5)16(13-9-10-13)14-7-6-8-15(19)11-14/h6-8,11-13,16-18H,9-10,20H2,1-5H3/t16-,17?,18?/m0/s1 |
| InChIKey | WKSRRGYVWYKMKD-AOCRQIFASA-N |
| XLogP | 4.52 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|