C20H34FNOSi — CID 141039550
tert-butyl-[1-(3-fluorophenyl)-4-pyrrolidin-2-ylbutan-2-yl]oxy-dimethylsilane (PubChem CID 141039550) has the molecular formula C20H34FNOSi and a molecular weight of 351.58 g/mol. Its IUPAC name is tert-butyl-[1-(3-fluorophenyl)-4-pyrrolidin-2-ylbutan-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[1-(3-fluorophenyl)-4-pyrrolidin-2-ylbutan-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 141039550 |
| Molecular Formula | C20H34FNOSi |
| Molecular Weight | 351.58 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | tert-butyl-[1-(3-fluorophenyl)-4-pyrrolidin-2-ylbutan-2-yl]oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC(CCC1CCCN1)Cc1cccc(F)c1 |
| InChI | InChI=1S/C20H34FNOSi/c1-20(2,3)24(4,5)23-19(12-11-18-10-7-13-22-18)15-16-8-6-9-17(21)14-16/h6,8-9,14,18-19,22H,7,10-13,15H2,1-5H3 |
| InChIKey | AVRXKIOXZGUKFS-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.58 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|