C20H32FNO2Si — CID 12970095
5-[3-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluorophenyl)butyl]pyrrolidin-2-one (PubChem CID 12970095) has the molecular formula C20H32FNO2Si and a molecular weight of 365.57 g/mol. Its IUPAC name is 5-[3-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluorophenyl)butyl]pyrrolidin-2-one.
| Compound Name | 5-[3-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluorophenyl)butyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 12970095 |
| Molecular Formula | C20H32FNO2Si |
| Molecular Weight | 365.57 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 5-[3-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluorophenyl)butyl]pyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC(CCC1CCC(=O)N1)Cc1cccc(F)c1 |
| InChI | InChI=1S/C20H32FNO2Si/c1-20(2,3)25(4,5)24-18(11-9-17-10-12-19(23)22-17)14-15-7-6-8-16(21)13-15/h6-8,13,17-18H,9-12,14H2,1-5H3,(H,22,23) |
| InChIKey | NNKQTVQXEWLWJP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|