C26H44FNO2Si — CID 155935101
N-cyclohexyl-3-(3-fluorophenyl)-3-methyl-4-tri(propan-2-yl)silyloxybutanamide (PubChem CID 155935101) has the molecular formula C26H44FNO2Si and a molecular weight of 449.73 g/mol. Its IUPAC name is N-cyclohexyl-3-(3-fluorophenyl)-3-methyl-4-tri(propan-2-yl)silyloxybutanamide.
| Compound Name | N-cyclohexyl-3-(3-fluorophenyl)-3-methyl-4-tri(propan-2-yl)silyloxybutanamide |
|---|---|
| PubChem CID | 155935101 |
| Molecular Formula | C26H44FNO2Si |
| Molecular Weight | 449.73 g/mol |
| Exact Mass | 449.31 |
| IUPAC Name | N-cyclohexyl-3-(3-fluorophenyl)-3-methyl-4-tri(propan-2-yl)silyloxybutanamide |
| SMILES | CC(C)[Si](OCC(C)(CC(=O)NC1CCCCC1)c1cccc(F)c1)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H44FNO2Si/c1-19(2)31(20(3)4,21(5)6)30-18-26(7,22-12-11-13-23(27)16-22)17-25(29)28-24-14-9-8-10-15-24/h11-13,16,19-21,24H,8-10,14-15,17-18H2,1-7H3,(H,28,29) |
| InChIKey | OTJGHUYDTBZZCE-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.73 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|