C20H31F2NO2Si — CID 146027475
(5S)-5-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-difluoro-4-phenylbutyl]pyrrolidin-2-one (PubChem CID 146027475) has the molecular formula C20H31F2NO2Si and a molecular weight of 383.56 g/mol. Its IUPAC name is (5S)-5-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-difluoro-4-phenylbutyl]pyrrolidin-2-one.
| Compound Name | (5S)-5-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-difluoro-4-phenylbutyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 146027475 |
| Molecular Formula | C20H31F2NO2Si |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | (5S)-5-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-difluoro-4-phenylbutyl]pyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CC[C@H]1CCC(=O)N1)C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C20H31F2NO2Si/c1-19(2,3)26(4,5)25-17(13-11-16-12-14-18(24)23-16)20(21,22)15-9-7-6-8-10-15/h6-10,16-17H,11-14H2,1-5H3,(H,23,24)/t16-,17-/m0/s1 |
| InChIKey | XIESJSPKPWSNNK-IRXDYDNUSA-N |
| XLogP | 5.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|