C27H43FN2O2Si — CID 22718758
7-[2-[3-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluorophenyl)butyl]-5-oxopyrrolidin-1-yl]heptanenitrile (PubChem CID 22718758) has the molecular formula C27H43FN2O2Si and a molecular weight of 474.74 g/mol. Its IUPAC name is 7-[2-[3-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluorophenyl)butyl]-5-oxopyrrolidin-1-yl]heptanenitrile.
| Compound Name | 7-[2-[3-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluorophenyl)butyl]-5-oxopyrrolidin-1-yl]heptanenitrile |
|---|---|
| PubChem CID | 22718758 |
| Molecular Formula | C27H43FN2O2Si |
| Molecular Weight | 474.74 g/mol |
| Exact Mass | 474.31 |
| IUPAC Name | 7-[2-[3-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluorophenyl)butyl]-5-oxopyrrolidin-1-yl]heptanenitrile |
| SMILES | CC(C)(C)[Si](C)(C)OC(CCC1CCC(=O)N1CCCCCCC#N)Cc1cccc(F)c1 |
| InChI | InChI=1S/C27H43FN2O2Si/c1-27(2,3)33(4,5)32-25(21-22-12-11-13-23(28)20-22)16-14-24-15-17-26(31)30(24)19-10-8-6-7-9-18-29/h11-13,20,24-25H,6-10,14-17,19,21H2,1-5H3 |
| InChIKey | XWVJVRWGZZWYMG-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.74 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|